C12H13F3OS2 — CID 14338624
1-(1,3-dithian-2-yl)-2,2,2-trifluoro-1-phenylethanol (PubChem CID 14338624) has the molecular formula C12H13F3OS2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-(1,3-dithian-2-yl)-2,2,2-trifluoro-1-phenylethanol.
| Compound Name | 1-(1,3-dithian-2-yl)-2,2,2-trifluoro-1-phenylethanol |
|---|---|
| PubChem CID | 14338624 |
| Molecular Formula | C12H13F3OS2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 1-(1,3-dithian-2-yl)-2,2,2-trifluoro-1-phenylethanol |
| SMILES | OC(c1ccccc1)(C1SCCCS1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3OS2/c13-12(14,15)11(16,9-5-2-1-3-6-9)10-17-7-4-8-18-10/h1-3,5-6,10,16H,4,7-8H2 |
| InChIKey | UWEOHMWNWYTSBD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |