About N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide
N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide (PubChem CID 143386396) has the molecular formula C9H8F3NO2
and a molecular weight of 219.16 g/mol. Its IUPAC name is N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide.
Molecular Properties
| Compound Name | N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide |
| PubChem CID | 143386396 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide |
| SMILES | O=CNC1=CC=CC(OC(F)(F)F)C=C1 |
| InChI | InChI=1S/C9H8F3NO2/c10-9(11,12)15-8-3-1-2-7(4-5-8)13-6-14/h1-6,8H,(H,13,14) |
| InChIKey | BSFIHHDTQIVRFJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide?
The IUPAC name of N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide (CID 143386396) is N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide.
What is the SMILES notation for N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide?
The canonical SMILES for N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide is O=CNC1=CC=CC(OC(F)(F)F)C=C1.
What is the InChIKey of N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide?
The InChIKey is BSFIHHDTQIVRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NO2/c10-9(11,12)15-8-3-1-2-7(4-5-8)13-6-14/h1-6,8H,(H,13,14).
What are the key properties of N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide?
N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide has a molecular weight of 219.16 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(trifluoromethoxy)cyclohepta-1,3,6-trien-1-yl]formamide is sourced from PubChem (CID 143386396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).