About 5-fluoro-6-methyl-1,3-benzothiazole;propane
5-fluoro-6-methyl-1,3-benzothiazole;propane (PubChem CID 143386612) has the molecular formula C11H14FNS
and a molecular weight of 211.30 g/mol. Its IUPAC name is 5-fluoro-6-methyl-1,3-benzothiazole;propane.
Molecular Properties
| Compound Name | 5-fluoro-6-methyl-1,3-benzothiazole;propane |
| PubChem CID | 143386612 |
| Molecular Formula | C11H14FNS |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 5-fluoro-6-methyl-1,3-benzothiazole;propane |
| SMILES | CCC.Cc1cc2scnc2cc1F |
| InChI | InChI=1S/C8H6FNS.C3H8/c1-5-2-8-7(3-6(5)9)10-4-11-8;1-3-2/h2-4H,1H3;3H2,1-2H3 |
| InChIKey | QCGRABHCWHRMML-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-6-methyl-1,3-benzothiazole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-methyl-1,3-benzothiazole;propane?
The IUPAC name of 5-fluoro-6-methyl-1,3-benzothiazole;propane (CID 143386612) is 5-fluoro-6-methyl-1,3-benzothiazole;propane.
What is the SMILES notation for 5-fluoro-6-methyl-1,3-benzothiazole;propane?
The canonical SMILES for 5-fluoro-6-methyl-1,3-benzothiazole;propane is CCC.Cc1cc2scnc2cc1F.
What is the InChIKey of 5-fluoro-6-methyl-1,3-benzothiazole;propane?
The InChIKey is QCGRABHCWHRMML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FNS.C3H8/c1-5-2-8-7(3-6(5)9)10-4-11-8;1-3-2/h2-4H,1H3;3H2,1-2H3.
What are the key properties of 5-fluoro-6-methyl-1,3-benzothiazole;propane?
5-fluoro-6-methyl-1,3-benzothiazole;propane has a molecular weight of 211.30 g/mol, XLogP of 4.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methyl-1,3-benzothiazole;propane is sourced from PubChem (CID 143386612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).