About 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline
4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline (PubChem CID 143386630) has the molecular formula C13H18INO
and a molecular weight of 331.20 g/mol. Its IUPAC name is 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline.
Molecular Properties
| Compound Name | 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline |
| PubChem CID | 143386630 |
| Molecular Formula | C13H18INO |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline |
| SMILES | COCCC1(CI)CCNc2ccccc21 |
| InChI | InChI=1S/C13H18INO/c1-16-9-7-13(10-14)6-8-15-12-5-3-2-4-11(12)13/h2-5,15H,6-10H2,1H3 |
| InChIKey | OVVUZRWCJDMGCT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline?
The IUPAC name of 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline (CID 143386630) is 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline.
What is the SMILES notation for 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline?
The canonical SMILES for 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline is COCCC1(CI)CCNc2ccccc21.
What is the InChIKey of 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline?
The InChIKey is OVVUZRWCJDMGCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18INO/c1-16-9-7-13(10-14)6-8-15-12-5-3-2-4-11(12)13/h2-5,15H,6-10H2,1H3.
What are the key properties of 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline?
4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline has a molecular weight of 331.20 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(iodomethyl)-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoline is sourced from PubChem (CID 143386630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).