About 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one
5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 143386784) has the molecular formula C6H9N5O
and a molecular weight of 167.17 g/mol. Its IUPAC name is 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 143386784 |
| Molecular Formula | C6H9N5O |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | Cc1nc2c(c(=O)n1C)NNN2 |
| InChI | InChI=1S/C6H9N5O/c1-3-7-5-4(8-10-9-5)6(12)11(3)2/h8-10H,1-2H3 |
| InChIKey | DRKMGAAOIBXRPV-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one (CID 143386784) is 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one is Cc1nc2c(c(=O)n1C)NNN2.
What is the InChIKey of 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one?
The InChIKey is DRKMGAAOIBXRPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5O/c1-3-7-5-4(8-10-9-5)6(12)11(3)2/h8-10H,1-2H3.
What are the key properties of 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one?
5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one has a molecular weight of 167.17 g/mol, XLogP of -0.65, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2,3-dihydro-1H-triazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 143386784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).