C32H42Cl2N4O4 — CID 143386834
2,4-dichloro-1-propylbenzene;N-[2-(4-formyl-1,4-diazepan-1-yl)-5-propanoylphenyl]furan-3-carboxamide;N-methylethanamine (PubChem CID 143386834) has the molecular formula C32H42Cl2N4O4 and a molecular weight of 617.62 g/mol. Its IUPAC name is 2,4-dichloro-1-propylbenzene;N-[2-(4-formyl-1,4-diazepan-1-yl)-5-propanoylphenyl]furan-3-carboxamide;N-methylethanamine.
| Compound Name | 2,4-dichloro-1-propylbenzene;N-[2-(4-formyl-1,4-diazepan-1-yl)-5-propanoylphenyl]furan-3-carboxamide;N-methylethanamine |
|---|---|
| PubChem CID | 143386834 |
| Molecular Formula | C32H42Cl2N4O4 |
| Molecular Weight | 617.62 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | 2,4-dichloro-1-propylbenzene;N-[2-(4-formyl-1,4-diazepan-1-yl)-5-propanoylphenyl]furan-3-carboxamide;N-methylethanamine |
| SMILES | CCC(=O)c1ccc(N2CCCN(C=O)CC2)c(NC(=O)c2ccoc2)c1.CCCc1ccc(Cl)cc1Cl.CCNC |
| InChI | InChI=1S/C20H23N3O4.C9H10Cl2.C3H9N/c1-2-19(25)15-4-5-18(23-8-3-7-22(14-24)9-10-23)17(12-15)21-20(26)16-6-11-27-13-16;1-2-3-7-4-5-8(10)6-9(7)11;1-3-4-2/h4-6,11-14H,2-3,7-10H2,1H3,(H,21,26);4-6H,2-3H2,1H3;4H,3H2,1-2H3 |
| InChIKey | QBTBLZSJGNPKCP-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|