About ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane
ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane (PubChem CID 143386964) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane.
Molecular Properties
| Compound Name | ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane |
| PubChem CID | 143386964 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane |
| SMILES | CC.CCC.CO/C(C)=C(C)\C=C\CN |
| InChI | InChI=1S/C8H15NO.C3H8.C2H6/c1-7(5-4-6-9)8(2)10-3;1-3-2;1-2/h4-5H,6,9H2,1-3H3;3H2,1-2H3;1-2H3/b5-4+,8-7-;; |
| InChIKey | LTZZOXFPGZGEER-GQPZGLEPSA-N |
| XLogP | 3.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane?
The IUPAC name of ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane (CID 143386964) is ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane.
What is the SMILES notation for ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane?
The canonical SMILES for ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane is CC.CCC.CO/C(C)=C(C)\C=C\CN.
What is the InChIKey of ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane?
The InChIKey is LTZZOXFPGZGEER-GQPZGLEPSA-N. The full InChI is InChI=1S/C8H15NO.C3H8.C2H6/c1-7(5-4-6-9)8(2)10-3;1-3-2;1-2/h4-5H,6,9H2,1-3H3;3H2,1-2H3;1-2H3/b5-4+,8-7-;;.
What are the key properties of ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane?
ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane has a molecular weight of 215.38 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E,4Z)-5-methoxy-4-methylhexa-2,4-dien-1-amine;propane is sourced from PubChem (CID 143386964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).