C9H12N4 — CID 143387525
4-methyl-N-[(3E)-penta-1,3-dien-3-yl]-1,3,5-triazin-2-amine (PubChem CID 143387525) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-methyl-N-[(3E)-penta-1,3-dien-3-yl]-1,3,5-triazin-2-amine.
| Compound Name | 4-methyl-N-[(3E)-penta-1,3-dien-3-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 143387525 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 4-methyl-N-[(3E)-penta-1,3-dien-3-yl]-1,3,5-triazin-2-amine |
| SMILES | C=C/C(=C\C)Nc1ncnc(C)n1 |
| InChI | InChI=1S/C9H12N4/c1-4-8(5-2)13-9-11-6-10-7(3)12-9/h4-6H,1H2,2-3H3,(H,10,11,12,13)/b8-5+ |
| InChIKey | OMWAZYHIYIKWKN-VMPITWQZSA-N |
| XLogP | 1.68 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|