About 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one
9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one (PubChem CID 143388479) has the molecular formula C10H11N4O3+
and a molecular weight of 235.22 g/mol. Its IUPAC name is 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one.
Molecular Properties
| Compound Name | 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one |
| PubChem CID | 143388479 |
| Molecular Formula | C10H11N4O3+ |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one |
| SMILES | O=c1[nH]cnc2c1[nH]c[n+]2C1C=CC(CO)O1 |
| InChI | InChI=1S/C10H10N4O3/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h1-2,4-7,15H,3H2,(H,11,12,16)/p+1 |
| InChIKey | TYQPBHYPIRLWKU-UHFFFAOYSA-O |
| XLogP | -1.02 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one?
The IUPAC name of 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one (CID 143388479) is 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one.
What is the SMILES notation for 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one?
The canonical SMILES for 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one is O=c1[nH]cnc2c1[nH]c[n+]2C1C=CC(CO)O1.
What is the InChIKey of 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one?
The InChIKey is TYQPBHYPIRLWKU-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H10N4O3/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h1-2,4-7,15H,3H2,(H,11,12,16)/p+1.
What are the key properties of 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one?
9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one has a molecular weight of 235.22 g/mol, XLogP of -1.02, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,7-dihydropurin-9-ium-6-one is sourced from PubChem (CID 143388479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).