About 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine
12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine (PubChem CID 143388491) has the molecular formula C18H19N3S
and a molecular weight of 309.44 g/mol. Its IUPAC name is 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine.
Molecular Properties
| Compound Name | 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine |
| PubChem CID | 143388491 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine |
| SMILES | c1ccc2c(c1)C/N=C(/N1CCNCC1)c1ccccc1S2 |
| InChI | InChI=1S/C18H19N3S/c1-3-7-16-14(5-1)13-20-18(21-11-9-19-10-12-21)15-6-2-4-8-17(15)22-16/h1-8,19H,9-13H2/b20-18+ |
| InChIKey | NXJJVSIOWYAXJP-CZIZESTLSA-N |
| XLogP | 3.00 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine?
The IUPAC name of 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine (CID 143388491) is 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine.
What is the SMILES notation for 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine?
The canonical SMILES for 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine is c1ccc2c(c1)C/N=C(/N1CCNCC1)c1ccccc1S2.
What is the InChIKey of 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine?
The InChIKey is NXJJVSIOWYAXJP-CZIZESTLSA-N. The full InChI is InChI=1S/C18H19N3S/c1-3-7-16-14(5-1)13-20-18(21-11-9-19-10-12-21)15-6-2-4-8-17(15)22-16/h1-8,19H,9-13H2/b20-18+.
What are the key properties of 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine?
12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine has a molecular weight of 309.44 g/mol, XLogP of 3.00, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 12-piperazin-1-yl-10H-benzo[b][1,5]benzothiazocine is sourced from PubChem (CID 143388491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).