C16H14 — CID 143388576
1-[(3Z)-5-cyclobuta-1,2,3-trien-1-ylhexa-1,3,5-trien-2-yl]cyclohexa-1,3-diene (PubChem CID 143388576) has the molecular formula C16H14 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-[(3Z)-5-cyclobuta-1,2,3-trien-1-ylhexa-1,3,5-trien-2-yl]cyclohexa-1,3-diene.
| Compound Name | 1-[(3Z)-5-cyclobuta-1,2,3-trien-1-ylhexa-1,3,5-trien-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143388576 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-[(3Z)-5-cyclobuta-1,2,3-trien-1-ylhexa-1,3,5-trien-2-yl]cyclohexa-1,3-diene |
| SMILES | C=C(/C=C\C(=C)C1=CC=CCC1)C1=C=C=C1 |
| InChI | InChI=1S/C16H14/c1-13(15-7-4-3-5-8-15)11-12-14(2)16-9-6-10-16/h3-4,7,9,11-12H,1-2,5,8H2/b12-11- |
| InChIKey | PWHSJJISAQEACS-QXMHVHEDSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|