C32H36 — CID 143388581
3-[(3E,7Z,11Z)-13-cyclohexa-1,3-dien-1-yl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-3-yl]bicyclo[3.1.0]hexa-1,3-diene;ethane (PubChem CID 143388581) has the molecular formula C32H36 and a molecular weight of 420.64 g/mol. Its IUPAC name is 3-[(3E,7Z,11Z)-13-cyclohexa-1,3-dien-1-yl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-3-yl]bicyclo[3.1.0]hexa-1,3-diene;ethane.
| Compound Name | 3-[(3E,7Z,11Z)-13-cyclohexa-1,3-dien-1-yl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-3-yl]bicyclo[3.1.0]hexa-1,3-diene;ethane |
|---|---|
| PubChem CID | 143388581 |
| Molecular Formula | C32H36 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 3-[(3E,7Z,11Z)-13-cyclohexa-1,3-dien-1-yl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-3-yl]bicyclo[3.1.0]hexa-1,3-diene;ethane |
| SMILES | C=C/C(=C/C(=C)C(=C)/C=C\C(=C)C(=C)/C=C\C(=C)C1=CC=CCC1)C1=CC2CC2=C1.CC |
| InChI | InChI=1S/C30H30.C2H6/c1-7-26(28-18-29-20-30(29)19-28)17-25(6)23(4)14-13-21(2)22(3)15-16-24(5)27-11-9-8-10-12-27;1-2/h7-9,11,13-19,29H,1-6,10,12,20H2;1-2H3/b14-13-,16-15-,26-17+; |
| InChIKey | MEYJNNUKKQOFHZ-GOIATEIRSA-N |
| XLogP | 9.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|