C41H40 — CID 143388720
1-[3-[(2Z,4E,6Z)-nona-2,4,6-trien-5-yl]phenyl]-3-[3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]phenyl]-5-phenylbenzene (PubChem CID 143388720) has the molecular formula C41H40 and a molecular weight of 532.77 g/mol. Its IUPAC name is 1-[3-[(2Z,4E,6Z)-nona-2,4,6-trien-5-yl]phenyl]-3-[3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]phenyl]-5-phenylbenzene.
| Compound Name | 1-[3-[(2Z,4E,6Z)-nona-2,4,6-trien-5-yl]phenyl]-3-[3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]phenyl]-5-phenylbenzene |
|---|---|
| PubChem CID | 143388720 |
| Molecular Formula | C41H40 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | 1-[3-[(2Z,4E,6Z)-nona-2,4,6-trien-5-yl]phenyl]-3-[3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]phenyl]-5-phenylbenzene |
| SMILES | C/C=C\C=C(/C=C\C)c1cccc(-c2cc(-c3ccccc3)cc(-c3cccc(C(/C=C\CC)=C/C=C\C)c3)c2)c1 |
| InChI | InChI=1S/C41H40/c1-5-9-18-32(17-8-4)35-23-15-25-37(27-35)40-29-39(34-21-13-12-14-22-34)30-41(31-40)38-26-16-24-36(28-38)33(19-10-6-2)20-11-7-3/h5-6,8-31H,7H2,1-4H3/b9-5-,10-6-,17-8-,20-11-,32-18+,33-19+ |
| InChIKey | XQZVKEURTNYFEC-BSFNQJOHSA-N |
| XLogP | 12.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|