C9H10F2N2O — CID 143389096
1-(2,5-difluorocyclohepta-1,4,6-trien-1-yl)-3-methylurea (PubChem CID 143389096) has the molecular formula C9H10F2N2O and a molecular weight of 200.19 g/mol. Its IUPAC name is 1-(2,5-difluorocyclohepta-1,4,6-trien-1-yl)-3-methylurea.
| Compound Name | 1-(2,5-difluorocyclohepta-1,4,6-trien-1-yl)-3-methylurea |
|---|---|
| PubChem CID | 143389096 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1-(2,5-difluorocyclohepta-1,4,6-trien-1-yl)-3-methylurea |
| SMILES | CNC(=O)NC1=C(F)CC=C(F)C=C1 |
| InChI | InChI=1S/C9H10F2N2O/c1-12-9(14)13-8-5-3-6(10)2-4-7(8)11/h2-3,5H,4H2,1H3,(H2,12,13,14) |
| InChIKey | RRSKPAKNWLAZKP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |