C25H39N7O6S+2 — CID 143389489
[(2R)-2-amino-4-methylpentanoyl]-[6-[[6-[[(E)-(2-sulfophenyl)methylideneamino]azaniumyl]-1,2-dihydropyridine-3-carbonyl]amino]hexanoylamino]azanium (PubChem CID 143389489) has the molecular formula C25H39N7O6S+2 and a molecular weight of 565.70 g/mol. Its IUPAC name is [(2R)-2-amino-4-methylpentanoyl]-[6-[[6-[[(E)-(2-sulfophenyl)methylideneamino]azaniumyl]-1,2-dihydropyridine-3-carbonyl]amino]hexanoylamino]azanium.
| Compound Name | [(2R)-2-amino-4-methylpentanoyl]-[6-[[6-[[(E)-(2-sulfophenyl)methylideneamino]azaniumyl]-1,2-dihydropyridine-3-carbonyl]amino]hexanoylamino]azanium |
|---|---|
| PubChem CID | 143389489 |
| Molecular Formula | C25H39N7O6S+2 |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | [(2R)-2-amino-4-methylpentanoyl]-[6-[[6-[[(E)-(2-sulfophenyl)methylideneamino]azaniumyl]-1,2-dihydropyridine-3-carbonyl]amino]hexanoylamino]azanium |
| SMILES | CC(C)C[C@@H](N)C(=O)[NH2+]NC(=O)CCCCCNC(=O)C1=CC=C([NH2+]/N=C/c2ccccc2S(=O)(=O)O)NC1 |
| InChI | InChI=1S/C25H37N7O6S/c1-17(2)14-20(26)25(35)32-31-23(33)10-4-3-7-13-27-24(34)19-11-12-22(28-15-19)30-29-16-18-8-5-6-9-21(18)39(36,37)38/h5-6,8-9,11-12,16-17,20,28,30H,3-4,7,10,13-15,26H2,1-2H3,(H,27,34)(H,31,33)(H,32,35)(H,36,37,38)/p+2/b29-16+/t20-/m1/s1 |
| InChIKey | MBZOCDPWFNBYBF-JHUOEDMDSA-P |
| XLogP | -1.63 |
| TPSA | 213.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|