About ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone
ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone (PubChem CID 143389522) has the molecular formula C24H35N3OS
and a molecular weight of 413.63 g/mol. Its IUPAC name is ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone |
| PubChem CID | 143389522 |
| Molecular Formula | C24H35N3OS |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone |
| SMILES | CC.CN1CCCCC1.O=C(c1ccc(Sc2cccnc2)cc1)N1CCCC1 |
| InChI | InChI=1S/C16H16N2OS.C6H13N.C2H6/c19-16(18-10-1-2-11-18)13-5-7-14(8-6-13)20-15-4-3-9-17-12-15;1-7-5-3-2-4-6-7;1-2/h3-9,12H,1-2,10-11H2;2-6H2,1H3;1-2H3 |
| InChIKey | GYYDANRAUIRIMS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone?
The IUPAC name of ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone (CID 143389522) is ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone.
What is the SMILES notation for ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone?
The canonical SMILES for ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone is CC.CN1CCCCC1.O=C(c1ccc(Sc2cccnc2)cc1)N1CCCC1.
What is the InChIKey of ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone?
The InChIKey is GYYDANRAUIRIMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2OS.C6H13N.C2H6/c19-16(18-10-1-2-11-18)13-5-7-14(8-6-13)20-15-4-3-9-17-12-15;1-7-5-3-2-4-6-7;1-2/h3-9,12H,1-2,10-11H2;2-6H2,1H3;1-2H3.
What are the key properties of ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone?
ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone has a molecular weight of 413.63 g/mol, XLogP of 5.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylpiperidine;(4-pyridin-3-ylsulfanylphenyl)-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 143389522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).