C21H22F4O5S2 — CID 14338987
15-tert-butyl-6,7,8,18-tetrafluoro-17-methoxy-3lambda6,11lambda6-dithiatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene 3,3,11,11-tetraoxide (PubChem CID 14338987) has the molecular formula C21H22F4O5S2 and a molecular weight of 494.53 g/mol. Its IUPAC name is 15-tert-butyl-6,7,8,18-tetrafluoro-17-methoxy-3lambda6,11lambda6-dithiatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene 3,3,11,11-tetraoxide.
| Compound Name | 15-tert-butyl-6,7,8,18-tetrafluoro-17-methoxy-3lambda6,11lambda6-dithiatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene 3,3,11,11-tetraoxide |
|---|---|
| PubChem CID | 14338987 |
| Molecular Formula | C21H22F4O5S2 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 15-tert-butyl-6,7,8,18-tetrafluoro-17-methoxy-3lambda6,11lambda6-dithiatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene 3,3,11,11-tetraoxide |
| SMILES | COc1c2cc(C(C)(C)C)cc1CS(=O)(=O)Cc1c(F)c(F)c(F)c(c1F)CS(=O)(=O)C2 |
| InChI | InChI=1S/C21H22F4O5S2/c1-21(2,3)13-5-11-7-31(26,27)9-14-16(22)15(18(24)19(25)17(14)23)10-32(28,29)8-12(6-13)20(11)30-4/h5-6H,7-10H2,1-4H3 |
| InChIKey | SFAFWMSHCNYYOP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|