C25H34N2S2 — CID 143390425
N-[2-(3,3-dimethylbutyl)phenyl]methanethioamide;8,8-dimethyl-3,4-dihydro-1H-cyclohepta[b]pyridine-2-thione (PubChem CID 143390425) has the molecular formula C25H34N2S2 and a molecular weight of 426.70 g/mol. Its IUPAC name is N-[2-(3,3-dimethylbutyl)phenyl]methanethioamide;8,8-dimethyl-3,4-dihydro-1H-cyclohepta[b]pyridine-2-thione.
| Compound Name | N-[2-(3,3-dimethylbutyl)phenyl]methanethioamide;8,8-dimethyl-3,4-dihydro-1H-cyclohepta[b]pyridine-2-thione |
|---|---|
| PubChem CID | 143390425 |
| Molecular Formula | C25H34N2S2 |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[2-(3,3-dimethylbutyl)phenyl]methanethioamide;8,8-dimethyl-3,4-dihydro-1H-cyclohepta[b]pyridine-2-thione |
| SMILES | CC(C)(C)CCc1ccccc1NC=S.CC1(C)C=CC=C2CCC(=S)NC2=C1 |
| InChI | InChI=1S/C13H19NS.C12H15NS/c1-13(2,3)9-8-11-6-4-5-7-12(11)14-10-15;1-12(2)7-3-4-9-5-6-11(14)13-10(9)8-12/h4-7,10H,8-9H2,1-3H3,(H,14,15);3-4,7-8H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | KLUOGDQVUSGYOP-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|