About 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid
2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid (PubChem CID 143390715) has the molecular formula C16H12N4O6S3
and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid.
Molecular Properties
| Compound Name | 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid |
| PubChem CID | 143390715 |
| Molecular Formula | C16H12N4O6S3 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid |
| SMILES | Nc1ccc(-n2nc3ccc4c(S(=O)O)cc(S(=O)O)cc4c3n2)cc1S(=O)O |
| InChI | InChI=1S/C16H12N4O6S3/c17-12-3-1-8(5-15(12)29(25)26)20-18-13-4-2-10-11(16(13)19-20)6-9(27(21)22)7-14(10)28(23)24/h1-7H,17H2,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | HWNFVSCUPVMQHO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 168.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid?
The IUPAC name of 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid (CID 143390715) is 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid.
What is the SMILES notation for 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid?
The canonical SMILES for 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid is Nc1ccc(-n2nc3ccc4c(S(=O)O)cc(S(=O)O)cc4c3n2)cc1S(=O)O.
What is the InChIKey of 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid?
The InChIKey is HWNFVSCUPVMQHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O6S3/c17-12-3-1-8(5-15(12)29(25)26)20-18-13-4-2-10-11(16(13)19-20)6-9(27(21)22)7-14(10)28(23)24/h1-7H,17H2,(H,21,22)(H,23,24)(H,25,26).
What are the key properties of 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid?
2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid has a molecular weight of 452.50 g/mol, XLogP of 1.90, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-3-sulfinophenyl)benzo[e]benzotriazole-6,8-disulfinic acid is sourced from PubChem (CID 143390715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).