C29H29N9O10S4 — CID 143390756
2-[[5-cyano-6-(2-hydroxyethylamino)-2-[2-(2-hydroxyethylsulfinyl)ethylamino]-4-methyl-3-pyridinyl]diazenyl]-5-(6,8-disulfinobenzo[e]benzotriazol-2-yl)benzenesulfonic acid (PubChem CID 143390756) has the molecular formula C29H29N9O10S4 and a molecular weight of 791.87 g/mol. Its IUPAC name is 2-[[5-cyano-6-(2-hydroxyethylamino)-2-[2-(2-hydroxyethylsulfinyl)ethylamino]-4-methyl-3-pyridinyl]diazenyl]-5-(6,8-disulfinobenzo[e]benzotriazol-2-yl)benzenesulfonic acid.
| Compound Name | 2-[[5-cyano-6-(2-hydroxyethylamino)-2-[2-(2-hydroxyethylsulfinyl)ethylamino]-4-methyl-3-pyridinyl]diazenyl]-5-(6,8-disulfinobenzo[e]benzotriazol-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 143390756 |
| Molecular Formula | C29H29N9O10S4 |
| Molecular Weight | 791.87 g/mol |
| Exact Mass | 791.09 |
| IUPAC Name | 2-[[5-cyano-6-(2-hydroxyethylamino)-2-[2-(2-hydroxyethylsulfinyl)ethylamino]-4-methyl-3-pyridinyl]diazenyl]-5-(6,8-disulfinobenzo[e]benzotriazol-2-yl)benzenesulfonic acid |
| SMILES | Cc1c(C#N)c(NCCO)nc(NCCS(=O)CCO)c1/N=N/c1ccc(-n2nc3ccc4c(S(=O)O)cc(S(=O)O)cc4c3n2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C29H29N9O10S4/c1-16-21(15-30)28(31-6-8-39)33-29(32-7-10-49(41)11-9-40)26(16)35-34-22-4-2-17(12-25(22)52(46,47)48)38-36-23-5-3-19-20(27(23)37-38)13-18(50(42)43)14-24(19)51(44)45/h2-5,12-14,39-40H,6-11H2,1H3,(H,42,43)(H,44,45)(H2,31,32,33)(H,46,47,48)/b35-34+ |
| InChIKey | ZJECPXAZBMZVOU-XAHDOWKMSA-N |
| XLogP | 2.53 |
| TPSA | 302.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.87 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|