C22H30N6O5S2 — CID 143390767
2-[[5-amino-2-(cyclohexylamino)-6-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid (PubChem CID 143390767) has the molecular formula C22H30N6O5S2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 2-[[5-amino-2-(cyclohexylamino)-6-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[5-amino-2-(cyclohexylamino)-6-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 143390767 |
| Molecular Formula | C22H30N6O5S2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 2-[[5-amino-2-(cyclohexylamino)-6-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid |
| SMILES | C=CS(=O)(=O)CCNc1nc(NC2CCCCC2)c(/N=N/c2ccccc2S(=O)(=O)O)c(C)c1N |
| InChI | InChI=1S/C22H30N6O5S2/c1-3-34(29,30)14-13-24-21-19(23)15(2)20(22(26-21)25-16-9-5-4-6-10-16)28-27-17-11-7-8-12-18(17)35(31,32)33/h3,7-8,11-12,16H,1,4-6,9-10,13-14,23H2,2H3,(H2,24,25,26)(H,31,32,33)/b28-27+ |
| InChIKey | TYIYVVLMZZSGLQ-BYYHNAKLSA-N |
| XLogP | 4.35 |
| TPSA | 176.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|