About 2,4-dibromobenzene-1,3,5-triol
2,4-dibromobenzene-1,3,5-triol (PubChem CID 14339091) has the molecular formula C6H4Br2O3
and a molecular weight of 283.90 g/mol. Its IUPAC name is 2,4-dibromobenzene-1,3,5-triol.
Molecular Properties
| Compound Name | 2,4-dibromobenzene-1,3,5-triol |
| PubChem CID | 14339091 |
| Molecular Formula | C6H4Br2O3 |
| Molecular Weight | 283.90 g/mol |
| Exact Mass | 281.85 |
| IUPAC Name | 2,4-dibromobenzene-1,3,5-triol |
| SMILES | Oc1cc(O)c(Br)c(O)c1Br |
| InChI | InChI=1S/C6H4Br2O3/c7-4-2(9)1-3(10)5(8)6(4)11/h1,9-11H |
| InChIKey | SNZHHFHFCLIISK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.90 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dibromobenzene-1,3,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromobenzene-1,3,5-triol?
The IUPAC name of 2,4-dibromobenzene-1,3,5-triol (CID 14339091) is 2,4-dibromobenzene-1,3,5-triol.
What is the SMILES notation for 2,4-dibromobenzene-1,3,5-triol?
The canonical SMILES for 2,4-dibromobenzene-1,3,5-triol is Oc1cc(O)c(Br)c(O)c1Br.
What is the InChIKey of 2,4-dibromobenzene-1,3,5-triol?
The InChIKey is SNZHHFHFCLIISK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br2O3/c7-4-2(9)1-3(10)5(8)6(4)11/h1,9-11H.
What are the key properties of 2,4-dibromobenzene-1,3,5-triol?
2,4-dibromobenzene-1,3,5-triol has a molecular weight of 283.90 g/mol, XLogP of 2.33, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromobenzene-1,3,5-triol is sourced from PubChem (CID 14339091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).