C16H20FN3O6S — CID 143391155
[2-(6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-fluoroethyl] 4-methylbenzenesulfonate (PubChem CID 143391155) has the molecular formula C16H20FN3O6S and a molecular weight of 401.42 g/mol. Its IUPAC name is [2-(6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-fluoroethyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-fluoroethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 143391155 |
| Molecular Formula | C16H20FN3O6S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [2-(6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-fluoroethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(F)C2OC3OC(C)(C)OC3C2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C16H20FN3O6S/c1-9-4-6-10(7-5-9)27(21,22)23-8-11(17)13-12(19-20-18)14-15(24-13)26-16(2,3)25-14/h4-7,11-15H,8H2,1-3H3 |
| InChIKey | QQWAOAPVSRAFSV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|