C27H32F4N2O4S — CID 143391254
1-[(3aR,6S,6aS)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-2-[[2,2,2-trifluoro-1-[3-(3-methylsulfonylphenyl)phenyl]ethyl]amino]pentan-1-one (PubChem CID 143391254) has the molecular formula C27H32F4N2O4S and a molecular weight of 556.62 g/mol. Its IUPAC name is 1-[(3aR,6S,6aS)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-2-[[2,2,2-trifluoro-1-[3-(3-methylsulfonylphenyl)phenyl]ethyl]amino]pentan-1-one.
| Compound Name | 1-[(3aR,6S,6aS)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-2-[[2,2,2-trifluoro-1-[3-(3-methylsulfonylphenyl)phenyl]ethyl]amino]pentan-1-one |
|---|---|
| PubChem CID | 143391254 |
| Molecular Formula | C27H32F4N2O4S |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 1-[(3aR,6S,6aS)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-2-[[2,2,2-trifluoro-1-[3-(3-methylsulfonylphenyl)phenyl]ethyl]amino]pentan-1-one |
| SMILES | CC(C)CC(NC(c1cccc(-c2cccc(S(C)(=O)=O)c2)c1)C(F)(F)F)C(=O)N1C[C@H](F)[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C27H32F4N2O4S/c1-16(2)12-22(26(34)33-15-21(28)24-23(33)10-11-37-24)32-25(27(29,30)31)19-8-4-6-17(13-19)18-7-5-9-20(14-18)38(3,35)36/h4-9,13-14,16,21-25,32H,10-12,15H2,1-3H3/t21-,22?,23+,24+,25?/m0/s1 |
| InChIKey | WLDPITHEXZCCEZ-WTEUAEKDSA-N |
| XLogP | 4.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |