C13H15N5O4S — CID 143392175
5-[(5-acetyl-1,2-oxazol-3-yl)diazenyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 143392175) has the molecular formula C13H15N5O4S and a molecular weight of 337.36 g/mol. Its IUPAC name is 5-[(5-acetyl-1,2-oxazol-3-yl)diazenyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(5-acetyl-1,2-oxazol-3-yl)diazenyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 143392175 |
| Molecular Formula | C13H15N5O4S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 5-[(5-acetyl-1,2-oxazol-3-yl)diazenyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCn1c(O)c(/N=N/c2cc(C(C)=O)on2)c(=O)n(CC)c1=S |
| InChI | InChI=1S/C13H15N5O4S/c1-4-17-11(20)10(12(21)18(5-2)13(17)23)15-14-9-6-8(7(3)19)22-16-9/h6,20H,4-5H2,1-3H3/b15-14+ |
| InChIKey | WVTOMNBQVXTOFS-CCEZHUSRSA-N |
| XLogP | 2.73 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|