C22H21N4O4S2+ — CID 143392235
(2E)-2-(4-cyclopropylsulfanylphenyl)-N-(6-nitroso-1,3-benzothiazol-3-ium-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 143392235) has the molecular formula C22H21N4O4S2+ and a molecular weight of 469.57 g/mol. Its IUPAC name is (2E)-2-(4-cyclopropylsulfanylphenyl)-N-(6-nitroso-1,3-benzothiazol-3-ium-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | (2E)-2-(4-cyclopropylsulfanylphenyl)-N-(6-nitroso-1,3-benzothiazol-3-ium-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 143392235 |
| Molecular Formula | C22H21N4O4S2+ |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | (2E)-2-(4-cyclopropylsulfanylphenyl)-N-(6-nitroso-1,3-benzothiazol-3-ium-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | O=Nc1ccc2[nH+]c(NC(=O)/C(=N/O[C@@H]3CCOC3)c3ccc(SC4CC4)cc3)sc2c1 |
| InChI | InChI=1S/C22H20N4O4S2/c27-21(24-22-23-18-8-3-14(25-28)11-19(18)32-22)20(26-30-15-9-10-29-12-15)13-1-4-16(5-2-13)31-17-6-7-17/h1-5,8,11,15,17H,6-7,9-10,12H2,(H,23,24,27)/p+1/b26-20+/t15-/m1/s1 |
| InChIKey | VZBIHFFSNTZDQQ-VDTAOSLHSA-O |
| XLogP | 4.52 |
| TPSA | 103.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|