About 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol
2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol (PubChem CID 143392421) has the molecular formula C15H22N2O3S
and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol |
| PubChem CID | 143392421 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol |
| SMILES | COCC(C)O.[H]/N=C(\C(N)=O)c1ccc(SC2CC2)cc1 |
| InChI | InChI=1S/C11H12N2OS.C4H10O2/c12-10(11(13)14)7-1-3-8(4-2-7)15-9-5-6-9;1-4(5)3-6-2/h1-4,9,12H,5-6H2,(H2,13,14);4-5H,3H2,1-2H3/b12-10-; |
| InChIKey | OVYFCDDELMMUJV-BBJSDXRSSA-N |
| XLogP | 1.81 |
| TPSA | 96.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol?
The IUPAC name of 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol (CID 143392421) is 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol.
What is the SMILES notation for 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol?
The canonical SMILES for 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol is COCC(C)O.[H]/N=C(\C(N)=O)c1ccc(SC2CC2)cc1.
What is the InChIKey of 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol?
The InChIKey is OVYFCDDELMMUJV-BBJSDXRSSA-N. The full InChI is InChI=1S/C11H12N2OS.C4H10O2/c12-10(11(13)14)7-1-3-8(4-2-7)15-9-5-6-9;1-4(5)3-6-2/h1-4,9,12H,5-6H2,(H2,13,14);4-5H,3H2,1-2H3/b12-10-;.
What are the key properties of 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol?
2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol has a molecular weight of 310.42 g/mol, XLogP of 1.81, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclopropylsulfanylphenyl)-2-iminoacetamide;1-methoxypropan-2-ol is sourced from PubChem (CID 143392421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).