About 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine
3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine (PubChem CID 143392646) has the molecular formula C15H27NO3S
and a molecular weight of 301.45 g/mol. Its IUPAC name is 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine.
Molecular Properties
| Compound Name | 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine |
| PubChem CID | 143392646 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine |
| SMILES | COCCCO.COCCCSc1ccc(CN)cc1 |
| InChI | InChI=1S/C11H17NOS.C4H10O2/c1-13-7-2-8-14-11-5-3-10(9-12)4-6-11;1-6-4-2-3-5/h3-6H,2,7-9,12H2,1H3;5H,2-4H2,1H3 |
| InChIKey | KMRLDEQPUQCJKI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine?
The IUPAC name of 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine (CID 143392646) is 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine.
What is the SMILES notation for 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine?
The canonical SMILES for 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine is COCCCO.COCCCSc1ccc(CN)cc1.
What is the InChIKey of 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine?
The InChIKey is KMRLDEQPUQCJKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NOS.C4H10O2/c1-13-7-2-8-14-11-5-3-10(9-12)4-6-11;1-6-4-2-3-5/h3-6H,2,7-9,12H2,1H3;5H,2-4H2,1H3.
What are the key properties of 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine?
3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine has a molecular weight of 301.45 g/mol, XLogP of 2.29, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropan-1-ol;[4-(3-methoxypropylsulfanyl)phenyl]methanamine is sourced from PubChem (CID 143392646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).