C14H22N4O — CID 143393034
ethane;3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;propane (PubChem CID 143393034) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is ethane;3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;propane.
| Compound Name | ethane;3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;propane |
|---|---|
| PubChem CID | 143393034 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | ethane;3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;propane |
| SMILES | CC.CCC.Cn1c(=O)[nH]c2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C9H8N4O.C3H8.C2H6/c1-13-7-5-2-3-10-8(5)11-4-6(7)12-9(13)14;1-3-2;1-2/h2-4H,1H3,(H,10,11)(H,12,14);3H2,1-2H3;1-2H3 |
| InChIKey | XXOWBNAQWWWYMN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |