C19H27ClN2OS — CID 143393638
N-(4-chlorophenyl)-6-methylpyridine-3-carboxamide;methylsulfanylethane;propane (PubChem CID 143393638) has the molecular formula C19H27ClN2OS and a molecular weight of 366.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6-methylpyridine-3-carboxamide;methylsulfanylethane;propane.
| Compound Name | N-(4-chlorophenyl)-6-methylpyridine-3-carboxamide;methylsulfanylethane;propane |
|---|---|
| PubChem CID | 143393638 |
| Molecular Formula | C19H27ClN2OS |
| Molecular Weight | 366.96 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(4-chlorophenyl)-6-methylpyridine-3-carboxamide;methylsulfanylethane;propane |
| SMILES | CCC.CCSC.Cc1ccc(C(=O)Nc2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C13H11ClN2O.C3H8S.C3H8/c1-9-2-3-10(8-15-9)13(17)16-12-6-4-11(14)5-7-12;1-3-4-2;1-3-2/h2-8H,1H3,(H,16,17);3H2,1-2H3;3H2,1-2H3 |
| InChIKey | SUHYPXQBLAENRW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.96 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |