C17H29NO2 — CID 143393972
3-[(2E,6Z)-octa-2,6-dienyl]-1-propan-2-ylpiperidine-3-carboxylic acid (PubChem CID 143393972) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 3-[(2E,6Z)-octa-2,6-dienyl]-1-propan-2-ylpiperidine-3-carboxylic acid.
| Compound Name | 3-[(2E,6Z)-octa-2,6-dienyl]-1-propan-2-ylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 143393972 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 3-[(2E,6Z)-octa-2,6-dienyl]-1-propan-2-ylpiperidine-3-carboxylic acid |
| SMILES | C/C=C\CC/C=C/CC1(C(=O)O)CCCN(C(C)C)C1 |
| InChI | InChI=1S/C17H29NO2/c1-4-5-6-7-8-9-11-17(16(19)20)12-10-13-18(14-17)15(2)3/h4-5,8-9,15H,6-7,10-14H2,1-3H3,(H,19,20)/b5-4-,9-8+ |
| InChIKey | UPJKRMJBGUMCBK-FTGFODROSA-N |
| XLogP | 3.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|