C23H25F2N7S — CID 143394959
4-N-ethyl-2-N-(2-ethyl-3H-1,2-benzothiazol-6-yl)-5-fluoro-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine;fluoromethane (PubChem CID 143394959) has the molecular formula C23H25F2N7S and a molecular weight of 469.57 g/mol. Its IUPAC name is 4-N-ethyl-2-N-(2-ethyl-3H-1,2-benzothiazol-6-yl)-5-fluoro-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine;fluoromethane.
| Compound Name | 4-N-ethyl-2-N-(2-ethyl-3H-1,2-benzothiazol-6-yl)-5-fluoro-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine;fluoromethane |
|---|---|
| PubChem CID | 143394959 |
| Molecular Formula | C23H25F2N7S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-N-ethyl-2-N-(2-ethyl-3H-1,2-benzothiazol-6-yl)-5-fluoro-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine;fluoromethane |
| SMILES | CCN1Cc2ccc(Nc3ncc(F)c(N(CC)c4cccc5[nH]ncc45)n3)cc2S1.CF |
| InChI | InChI=1S/C22H22FN7S.CH3F/c1-3-29-13-14-8-9-15(10-20(14)31-29)26-22-24-12-17(23)21(27-22)30(4-2)19-7-5-6-18-16(19)11-25-28-18;1-2/h5-12H,3-4,13H2,1-2H3,(H,25,28)(H,24,26,27);1H3 |
| InChIKey | CCZXQLKACHJHRG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|