About 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine
3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine (PubChem CID 143394968) has the molecular formula C21H32N2O
and a molecular weight of 328.50 g/mol. Its IUPAC name is 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine.
Molecular Properties
| Compound Name | 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine |
| PubChem CID | 143394968 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine |
| SMILES | C=CC(C)C(CCN)CC(C)CC1=C2C=C(OC)C=CC2NC=C1 |
| InChI | InChI=1S/C21H32N2O/c1-5-16(3)17(8-10-22)12-15(2)13-18-9-11-23-21-7-6-19(24-4)14-20(18)21/h5-7,9,11,14-17,21,23H,1,8,10,12-13,22H2,2-4H3 |
| InChIKey | KKHSIRHRZQLWIU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine?
The IUPAC name of 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine (CID 143394968) is 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine.
What is the SMILES notation for 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine?
The canonical SMILES for 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine is C=CC(C)C(CCN)CC(C)CC1=C2C=C(OC)C=CC2NC=C1.
What is the InChIKey of 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine?
The InChIKey is KKHSIRHRZQLWIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2O/c1-5-16(3)17(8-10-22)12-15(2)13-18-9-11-23-21-7-6-19(24-4)14-20(18)21/h5-7,9,11,14-17,21,23H,1,8,10,12-13,22H2,2-4H3.
What are the key properties of 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine?
3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine has a molecular weight of 328.50 g/mol, XLogP of 4.07, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(6-methoxy-1,8a-dihydroquinolin-4-yl)-2-methylpropyl]-4-methylhex-5-en-1-amine is sourced from PubChem (CID 143394968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).