C22H27Cl3N4O — CID 143395100
N'-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N',4-dimethylpyrazolidine-3-carbohydrazide (PubChem CID 143395100) has the molecular formula C22H27Cl3N4O and a molecular weight of 469.84 g/mol. Its IUPAC name is N'-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N',4-dimethylpyrazolidine-3-carbohydrazide.
| Compound Name | N'-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N',4-dimethylpyrazolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 143395100 |
| Molecular Formula | C22H27Cl3N4O |
| Molecular Weight | 469.84 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N'-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N',4-dimethylpyrazolidine-3-carbohydrazide |
| SMILES | CCCCN(C)NC(=O)C1NN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1C |
| InChI | InChI=1S/C22H27Cl3N4O/c1-4-5-12-28(3)27-22(30)20-14(2)21(15-6-8-16(23)9-7-15)29(26-20)19-11-10-17(24)13-18(19)25/h6-11,13-14,20-21,26H,4-5,12H2,1-3H3,(H,27,30) |
| InChIKey | QRJPHQFWGYVEMS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.84 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|