C9H20S — CID 143395307
1-ethyl-1,3-dimethylthiane (PubChem CID 143395307) has the molecular formula C9H20S and a molecular weight of 160.33 g/mol. Its IUPAC name is 1-ethyl-1,3-dimethylthiane.
| Compound Name | 1-ethyl-1,3-dimethylthiane |
|---|---|
| PubChem CID | 143395307 |
| Molecular Formula | C9H20S |
| Molecular Weight | 160.33 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1-ethyl-1,3-dimethylthiane |
| SMILES | CCS1(C)CCCC(C)C1 |
| InChI | InChI=1S/C9H20S/c1-4-10(3)7-5-6-9(2)8-10/h9H,4-8H2,1-3H3 |
| InChIKey | HREXKEPLVGDAJF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |