C25H34O6 — CID 143395774
[(8S)-8-[(3E,5E)-4,6-dimethoxyhexa-1,3,5-trien-2-yl]-4a-methyl-5-propan-2-yl-6,7,8,8a-tetrahydro-5H-benzo[f][1,3]benzodioxol-6-yl]methyl formate (PubChem CID 143395774) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [(8S)-8-[(3E,5E)-4,6-dimethoxyhexa-1,3,5-trien-2-yl]-4a-methyl-5-propan-2-yl-6,7,8,8a-tetrahydro-5H-benzo[f][1,3]benzodioxol-6-yl]methyl formate.
| Compound Name | [(8S)-8-[(3E,5E)-4,6-dimethoxyhexa-1,3,5-trien-2-yl]-4a-methyl-5-propan-2-yl-6,7,8,8a-tetrahydro-5H-benzo[f][1,3]benzodioxol-6-yl]methyl formate |
|---|---|
| PubChem CID | 143395774 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [(8S)-8-[(3E,5E)-4,6-dimethoxyhexa-1,3,5-trien-2-yl]-4a-methyl-5-propan-2-yl-6,7,8,8a-tetrahydro-5H-benzo[f][1,3]benzodioxol-6-yl]methyl formate |
| SMILES | C=C(/C=C(\C=C\OC)OC)[C@H]1CC(COC=O)C(C(C)C)C2(C)C=C3OCOC3=CC12 |
| InChI | InChI=1S/C25H34O6/c1-16(2)24-18(13-29-14-26)10-20(17(3)9-19(28-6)7-8-27-5)21-11-22-23(31-15-30-22)12-25(21,24)4/h7-9,11-12,14,16,18,20-21,24H,3,10,13,15H2,1-2,4-6H3/b8-7+,19-9+/t18?,20-,21?,24?,25?/m1/s1 |
| InChIKey | NHZWHBLCOHPSRB-VJIKWBCFSA-N |
| XLogP | 4.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|