About 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole
4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole (PubChem CID 143396108) has the molecular formula C22H29N3S
and a molecular weight of 367.56 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole |
| PubChem CID | 143396108 |
| Molecular Formula | C22H29N3S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole |
| SMILES | Cc1ccc2c(C3CCNC3)cn(C)c2c1.NCCc1ccc(S)cc1 |
| InChI | InChI=1S/C14H18N2.C8H11NS/c1-10-3-4-12-13(11-5-6-15-8-11)9-16(2)14(12)7-10;9-6-5-7-1-3-8(10)4-2-7/h3-4,7,9,11,15H,5-6,8H2,1-2H3;1-4,10H,5-6,9H2 |
| InChIKey | HYPRHSJYSSYGNB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole?
The IUPAC name of 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole (CID 143396108) is 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole.
What is the SMILES notation for 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole?
The canonical SMILES for 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole is Cc1ccc2c(C3CCNC3)cn(C)c2c1.NCCc1ccc(S)cc1.
What is the InChIKey of 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole?
The InChIKey is HYPRHSJYSSYGNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2.C8H11NS/c1-10-3-4-12-13(11-5-6-15-8-11)9-16(2)14(12)7-10;9-6-5-7-1-3-8(10)4-2-7/h3-4,7,9,11,15H,5-6,8H2,1-2H3;1-4,10H,5-6,9H2.
What are the key properties of 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole?
4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole has a molecular weight of 367.56 g/mol, XLogP of 4.04, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)benzenethiol;1,6-dimethyl-3-pyrrolidin-3-ylindole is sourced from PubChem (CID 143396108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).