C19H25NO2 — CID 143396477
N,N-dimethyl-2-(4-phenylmethoxyphenyl)acetamide;ethane (PubChem CID 143396477) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-phenylmethoxyphenyl)acetamide;ethane.
| Compound Name | N,N-dimethyl-2-(4-phenylmethoxyphenyl)acetamide;ethane |
|---|---|
| PubChem CID | 143396477 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | N,N-dimethyl-2-(4-phenylmethoxyphenyl)acetamide;ethane |
| SMILES | CC.CN(C)C(=O)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO2.C2H6/c1-18(2)17(19)12-14-8-10-16(11-9-14)20-13-15-6-4-3-5-7-15;1-2/h3-11H,12-13H2,1-2H3;1-2H3 |
| InChIKey | GKMJILLQUNLEPD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |