C25H33N5O — CID 143396564
2,3-dihydro-1H-indene-2-carbaldehyde;N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine (PubChem CID 143396564) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene-2-carbaldehyde;N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine.
| Compound Name | 2,3-dihydro-1H-indene-2-carbaldehyde;N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143396564 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 2,3-dihydro-1H-indene-2-carbaldehyde;N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNc1nc(CN(C)C)nc2ccccc12.O=CC1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H23N5.C10H10O/c1-16-9-6-10-17-15-12-7-4-5-8-13(12)18-14(19-15)11-20(2)3;11-7-8-5-9-3-1-2-4-10(9)6-8/h4-5,7-8,16H,6,9-11H2,1-3H3,(H,17,18,19);1-4,7-8H,5-6H2 |
| InChIKey | DGYZIYYSOHQZEE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|