About 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane
2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane (PubChem CID 143396949) has the molecular formula C17H30N4O2
and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane.
Molecular Properties
| Compound Name | 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane |
| PubChem CID | 143396949 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane |
| SMILES | CC.CC.COC.NCc1nc(NCC=O)c2ccccc2n1 |
| InChI | InChI=1S/C11H12N4O.C2H6O.2C2H6/c12-7-10-14-9-4-2-1-3-8(9)11(15-10)13-5-6-16;1-3-2;2*1-2/h1-4,6H,5,7,12H2,(H,13,14,15);1-2H3;2*1-2H3 |
| InChIKey | RYIFHRURVAEYQF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane?
The IUPAC name of 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane (CID 143396949) is 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane.
What is the SMILES notation for 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane?
The canonical SMILES for 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane is CC.CC.COC.NCc1nc(NCC=O)c2ccccc2n1.
What is the InChIKey of 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane?
The InChIKey is RYIFHRURVAEYQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O.C2H6O.2C2H6/c12-7-10-14-9-4-2-1-3-8(9)11(15-10)13-5-6-16;1-3-2;2*1-2/h1-4,6H,5,7,12H2,(H,13,14,15);1-2H3;2*1-2H3.
What are the key properties of 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane?
2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane has a molecular weight of 322.45 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetaldehyde;ethane;methoxymethane is sourced from PubChem (CID 143396949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).