C25H24ClN7O2 — CID 143397408
3-[(11R)-11-(1-chloroethyl)-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),13(21),14,16,18-pentaene-6-carbonyl]benzonitrile (PubChem CID 143397408) has the molecular formula C25H24ClN7O2 and a molecular weight of 489.97 g/mol. Its IUPAC name is 3-[(11R)-11-(1-chloroethyl)-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),13(21),14,16,18-pentaene-6-carbonyl]benzonitrile.
| Compound Name | 3-[(11R)-11-(1-chloroethyl)-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),13(21),14,16,18-pentaene-6-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 143397408 |
| Molecular Formula | C25H24ClN7O2 |
| Molecular Weight | 489.97 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 3-[(11R)-11-(1-chloroethyl)-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),13(21),14,16,18-pentaene-6-carbonyl]benzonitrile |
| SMILES | CC(Cl)[C@@H]1Nc2nc(nc3ccccc23)CN2CCN(C(=O)c3cccc(C#N)c3)CC2NC1=O |
| InChI | InChI=1S/C25H24ClN7O2/c1-15(26)22-24(34)30-21-14-33(25(35)17-6-4-5-16(11-17)12-27)10-9-32(21)13-20-28-19-8-3-2-7-18(19)23(29-20)31-22/h2-8,11,15,21-22H,9-10,13-14H2,1H3,(H,30,34)(H,28,29,31)/t15?,21?,22-/m0/s1 |
| InChIKey | SNLXCROAJLANCU-KGSCVUAUSA-N |
| XLogP | 2.32 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.97 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|