C29H44N6O — CID 143397577
(12S)-6-(4-tert-butylcyclohexyl)-12-propan-2-yl-3,6,10,13,21,22-hexazatetracyclo[12.7.1.03,8.015,20]docosa-1(21),14(22),15,17,19-pentaen-11-one (PubChem CID 143397577) has the molecular formula C29H44N6O and a molecular weight of 492.71 g/mol. Its IUPAC name is (12S)-6-(4-tert-butylcyclohexyl)-12-propan-2-yl-3,6,10,13,21,22-hexazatetracyclo[12.7.1.03,8.015,20]docosa-1(21),14(22),15,17,19-pentaen-11-one.
| Compound Name | (12S)-6-(4-tert-butylcyclohexyl)-12-propan-2-yl-3,6,10,13,21,22-hexazatetracyclo[12.7.1.03,8.015,20]docosa-1(21),14(22),15,17,19-pentaen-11-one |
|---|---|
| PubChem CID | 143397577 |
| Molecular Formula | C29H44N6O |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.36 |
| IUPAC Name | (12S)-6-(4-tert-butylcyclohexyl)-12-propan-2-yl-3,6,10,13,21,22-hexazatetracyclo[12.7.1.03,8.015,20]docosa-1(21),14(22),15,17,19-pentaen-11-one |
| SMILES | CC(C)[C@@H]1Nc2nc(nc3ccccc23)CN2CCN(C3CCC(C(C)(C)C)CC3)CC2CNC1=O |
| InChI | InChI=1S/C29H44N6O/c1-19(2)26-28(36)30-16-22-17-34(21-12-10-20(11-13-21)29(3,4)5)14-15-35(22)18-25-31-24-9-7-6-8-23(24)27(32-25)33-26/h6-9,19-22,26H,10-18H2,1-5H3,(H,30,36)(H,31,32,33)/t20?,21?,22?,26-/m0/s1 |
| InChIKey | ZXZRGLCEBRIPQU-MPGGCZQGSA-N |
| XLogP | 4.29 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |