C28H33ClN6O3 — CID 143397700
ethyl 4-[[(11R)-11-(1-chloroethyl)-9-methyl-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),13(21),14,16,18-pentaen-6-yl]methyl]benzoate (PubChem CID 143397700) has the molecular formula C28H33ClN6O3 and a molecular weight of 537.06 g/mol. Its IUPAC name is ethyl 4-[[(11R)-11-(1-chloroethyl)-9-methyl-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),13(21),14,16,18-pentaen-6-yl]methyl]benzoate.
| Compound Name | ethyl 4-[[(11R)-11-(1-chloroethyl)-9-methyl-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),13(21),14,16,18-pentaen-6-yl]methyl]benzoate |
|---|---|
| PubChem CID | 143397700 |
| Molecular Formula | C28H33ClN6O3 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | ethyl 4-[[(11R)-11-(1-chloroethyl)-9-methyl-10-oxo-3,6,9,12,20,21-hexazatetracyclo[11.7.1.03,8.014,19]henicosa-1(20),13(21),14,16,18-pentaen-6-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN2CCN3Cc4nc(c5ccccc5n4)N[C@@H](C(C)Cl)C(=O)N(C)C3C2)cc1 |
| InChI | InChI=1S/C28H33ClN6O3/c1-4-38-28(37)20-11-9-19(10-12-20)15-34-13-14-35-16-23-30-22-8-6-5-7-21(22)26(31-23)32-25(18(2)29)27(36)33(3)24(35)17-34/h5-12,18,24-25H,4,13-17H2,1-3H3,(H,30,31,32)/t18?,24?,25-/m0/s1 |
| InChIKey | NOHFXKTWMHPYME-VHNLKAGOSA-N |
| XLogP | 3.33 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|