About ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate
ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate (PubChem CID 143398058) has the molecular formula C20H13F3N4O4S
and a molecular weight of 462.41 g/mol. Its IUPAC name is ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate |
| PubChem CID | 143398058 |
| Molecular Formula | C20H13F3N4O4S |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate |
| SMILES | CCOC(=O)c1nnc(-c2cccc(C(F)(F)F)c2)nc1S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H13F3N4O4S/c1-2-31-19(28)16-18(32(29,30)15-8-6-12(11-24)7-9-15)25-17(27-26-16)13-4-3-5-14(10-13)20(21,22)23/h3-10H,2H2,1H3 |
| InChIKey | FAKPPHYHAJAZKK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 122.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate?
The IUPAC name of ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate (CID 143398058) is ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate.
What is the SMILES notation for ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate?
The canonical SMILES for ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate is CCOC(=O)c1nnc(-c2cccc(C(F)(F)F)c2)nc1S(=O)(=O)c1ccc(C#N)cc1.
What is the InChIKey of ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate?
The InChIKey is FAKPPHYHAJAZKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F3N4O4S/c1-2-31-19(28)16-18(32(29,30)15-8-6-12(11-24)7-9-15)25-17(27-26-16)13-4-3-5-14(10-13)20(21,22)23/h3-10H,2H2,1H3.
What are the key properties of ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate?
ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate has a molecular weight of 462.41 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(4-cyanophenyl)sulfonyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylate is sourced from PubChem (CID 143398058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).