About ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one
ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one (PubChem CID 143398323) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one.
Molecular Properties
| Compound Name | ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one |
| PubChem CID | 143398323 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one |
| SMILES | C=C/C=C(\C=C)CN1CCC(=O)CC1.CC |
| InChI | InChI=1S/C12H17NO.C2H6/c1-3-5-11(4-2)10-13-8-6-12(14)7-9-13;1-2/h3-5H,1-2,6-10H2;1-2H3/b11-5+; |
| InChIKey | HKNIQQORKVNLBZ-HMXKFKBXSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one?
The IUPAC name of ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one (CID 143398323) is ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one.
What is the SMILES notation for ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one?
The canonical SMILES for ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one is C=C/C=C(\C=C)CN1CCC(=O)CC1.CC.
What is the InChIKey of ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one?
The InChIKey is HKNIQQORKVNLBZ-HMXKFKBXSA-N. The full InChI is InChI=1S/C12H17NO.C2H6/c1-3-5-11(4-2)10-13-8-6-12(14)7-9-13;1-2/h3-5H,1-2,6-10H2;1-2H3/b11-5+;.
What are the key properties of ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one?
ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one has a molecular weight of 221.34 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-one is sourced from PubChem (CID 143398323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).