C26H29F5N2O — CID 143398504
(2S)-2-[[1-[4-(2,6-difluorophenyl)phenyl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide;(3Z)-hexa-1,3,5-triene (PubChem CID 143398504) has the molecular formula C26H29F5N2O and a molecular weight of 480.52 g/mol. Its IUPAC name is (2S)-2-[[1-[4-(2,6-difluorophenyl)phenyl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide;(3Z)-hexa-1,3,5-triene.
| Compound Name | (2S)-2-[[1-[4-(2,6-difluorophenyl)phenyl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide;(3Z)-hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143398504 |
| Molecular Formula | C26H29F5N2O |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | (2S)-2-[[1-[4-(2,6-difluorophenyl)phenyl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide;(3Z)-hexa-1,3,5-triene |
| SMILES | C=C/C=C\C=C.CC(C)C[C@H](NC(c1ccc(-c2c(F)cccc2F)cc1)C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C20H21F5N2O.C6H8/c1-11(2)10-16(19(26)28)27-18(20(23,24)25)13-8-6-12(7-9-13)17-14(21)4-3-5-15(17)22;1-3-5-6-4-2/h3-9,11,16,18,27H,10H2,1-2H3,(H2,26,28);3-6H,1-2H2/b;6-5-/t16-,18?;/m0./s1 |
| InChIKey | GERGFSCPWFGCQA-HQEVUPKHSA-N |
| XLogP | 6.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|