About (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine
(3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine (PubChem CID 143398990) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine.
Molecular Properties
| Compound Name | (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine |
| PubChem CID | 143398990 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C)N(C)CCCC)OC |
| InChI | InChI=1S/C12H21NO/c1-6-7-10-13(4)11(2)8-9-12(3)14-5/h8-9H,2-3,6-7,10H2,1,4-5H3/b9-8- |
| InChIKey | TZWNZQOEEIXTBZ-HJWRWDBZSA-N |
| XLogP | 2.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine?
The IUPAC name of (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine (CID 143398990) is (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine.
What is the SMILES notation for (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine?
The canonical SMILES for (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine is C=C(/C=C\C(=C)N(C)CCCC)OC.
What is the InChIKey of (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine?
The InChIKey is TZWNZQOEEIXTBZ-HJWRWDBZSA-N. The full InChI is InChI=1S/C12H21NO/c1-6-7-10-13(4)11(2)8-9-12(3)14-5/h8-9H,2-3,6-7,10H2,1,4-5H3/b9-8-.
What are the key properties of (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine?
(3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine has a molecular weight of 195.31 g/mol, XLogP of 2.95, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N-butyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine is sourced from PubChem (CID 143398990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).