About 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane
5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane (PubChem CID 143399613) has the molecular formula C16H20BrF3N2
and a molecular weight of 377.25 g/mol. Its IUPAC name is 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane.
Molecular Properties
| Compound Name | 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane |
| PubChem CID | 143399613 |
| Molecular Formula | C16H20BrF3N2 |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane |
| SMILES | C.CC.FC(F)(F)c1ccc(CNc2ccc(Br)cn2)cc1 |
| InChI | InChI=1S/C13H10BrF3N2.C2H6.CH4/c14-11-5-6-12(19-8-11)18-7-9-1-3-10(4-2-9)13(15,16)17;1-2;/h1-6,8H,7H2,(H,18,19);1-2H3;1H4 |
| InChIKey | FFUWXFAJNPKAOF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane?
The IUPAC name of 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane (CID 143399613) is 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane.
What is the SMILES notation for 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane?
The canonical SMILES for 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane is C.CC.FC(F)(F)c1ccc(CNc2ccc(Br)cn2)cc1.
What is the InChIKey of 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane?
The InChIKey is FFUWXFAJNPKAOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrF3N2.C2H6.CH4/c14-11-5-6-12(19-8-11)18-7-9-1-3-10(4-2-9)13(15,16)17;1-2;/h1-6,8H,7H2,(H,18,19);1-2H3;1H4.
What are the key properties of 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane?
5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane has a molecular weight of 377.25 g/mol, XLogP of 6.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-amine;ethane;methane is sourced from PubChem (CID 143399613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).