C17H14F2N2O — CID 143399921
3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-1-(4-fluorophenyl)pyrazole-4-carbaldehyde (PubChem CID 143399921) has the molecular formula C17H14F2N2O and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-1-(4-fluorophenyl)pyrazole-4-carbaldehyde.
| Compound Name | 3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-1-(4-fluorophenyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 143399921 |
| Molecular Formula | C17H14F2N2O |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-1-(4-fluorophenyl)pyrazole-4-carbaldehyde |
| SMILES | C/C=C\C(F)=C/C=C/c1nn(-c2ccc(F)cc2)cc1C=O |
| InChI | InChI=1S/C17H14F2N2O/c1-2-4-14(18)5-3-6-17-13(12-22)11-21(20-17)16-9-7-15(19)8-10-16/h2-12H,1H3/b4-2-,6-3+,14-5+ |
| InChIKey | CIAQYCJJDPZZDY-WGBJABTQSA-N |
| XLogP | 4.27 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|