About 2,4a-dihydroquinoline-3,4-dione;hydrochloride
2,4a-dihydroquinoline-3,4-dione;hydrochloride (PubChem CID 143400699) has the molecular formula C9H8ClNO2
and a molecular weight of 197.62 g/mol. Its IUPAC name is 2,4a-dihydroquinoline-3,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 2,4a-dihydroquinoline-3,4-dione;hydrochloride |
| PubChem CID | 143400699 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 2,4a-dihydroquinoline-3,4-dione;hydrochloride |
| SMILES | Cl.O=C1CN=C2C=CC=CC2C1=O |
| InChI | InChI=1S/C9H7NO2.ClH/c11-8-5-10-7-4-2-1-3-6(7)9(8)12;/h1-4,6H,5H2;1H |
| InChIKey | VXYJBWOXFFUMKB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,4a-dihydroquinoline-3,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4a-dihydroquinoline-3,4-dione;hydrochloride?
The IUPAC name of 2,4a-dihydroquinoline-3,4-dione;hydrochloride (CID 143400699) is 2,4a-dihydroquinoline-3,4-dione;hydrochloride.
What is the SMILES notation for 2,4a-dihydroquinoline-3,4-dione;hydrochloride?
The canonical SMILES for 2,4a-dihydroquinoline-3,4-dione;hydrochloride is Cl.O=C1CN=C2C=CC=CC2C1=O.
What is the InChIKey of 2,4a-dihydroquinoline-3,4-dione;hydrochloride?
The InChIKey is VXYJBWOXFFUMKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.ClH/c11-8-5-10-7-4-2-1-3-6(7)9(8)12;/h1-4,6H,5H2;1H.
What are the key properties of 2,4a-dihydroquinoline-3,4-dione;hydrochloride?
2,4a-dihydroquinoline-3,4-dione;hydrochloride has a molecular weight of 197.62 g/mol, XLogP of 0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4a-dihydroquinoline-3,4-dione;hydrochloride is sourced from PubChem (CID 143400699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).